C22H23N3O5S — CID 171339353
formic acid;N-(2-methoxy-4-morpholin-4-ylphenyl)-3-(1,2-thiazol-5-yl)benzamide (PubChem CID 171339353) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is formic acid;N-(2-methoxy-4-morpholin-4-ylphenyl)-3-(1,2-thiazol-5-yl)benzamide.
| Compound Name | formic acid;N-(2-methoxy-4-morpholin-4-ylphenyl)-3-(1,2-thiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 171339353 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | formic acid;N-(2-methoxy-4-morpholin-4-ylphenyl)-3-(1,2-thiazol-5-yl)benzamide |
| SMILES | COc1cc(N2CCOCC2)ccc1NC(=O)c1cccc(-c2ccns2)c1.O=CO |
| InChI | InChI=1S/C21H21N3O3S.CH2O2/c1-26-19-14-17(24-9-11-27-12-10-24)5-6-18(19)23-21(25)16-4-2-3-15(13-16)20-7-8-22-28-20;2-1-3/h2-8,13-14H,9-12H2,1H3,(H,23,25);1H,(H,2,3) |
| InChIKey | PVFYVWXGQLFGNU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|