C22H21NO3 — CID 171340585
4-[(3-methylphenyl)methylidene]-2-phenyl-6-oxa-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 171340585) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-[(3-methylphenyl)methylidene]-2-phenyl-6-oxa-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | 4-[(3-methylphenyl)methylidene]-2-phenyl-6-oxa-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 171340585 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-[(3-methylphenyl)methylidene]-2-phenyl-6-oxa-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | Cc1cccc(C=C2C(=O)N(c3ccccc3)C(=O)C23CCCCO3)c1 |
| InChI | InChI=1S/C22H21NO3/c1-16-8-7-9-17(14-16)15-19-20(24)23(18-10-3-2-4-11-18)21(25)22(19)12-5-6-13-26-22/h2-4,7-11,14-15H,5-6,12-13H2,1H3 |
| InChIKey | MEUNUELXHBXGGR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|