C22H20ClNO3 — CID 170913241
(4E)-2-(4-chlorophenyl)-4-[(4-methylphenyl)methylidene]-6-oxa-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 170913241) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is (4E)-2-(4-chlorophenyl)-4-[(4-methylphenyl)methylidene]-6-oxa-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | (4E)-2-(4-chlorophenyl)-4-[(4-methylphenyl)methylidene]-6-oxa-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 170913241 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (4E)-2-(4-chlorophenyl)-4-[(4-methylphenyl)methylidene]-6-oxa-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | Cc1ccc(/C=C2/C(=O)N(c3ccc(Cl)cc3)C(=O)C23CCCCO3)cc1 |
| InChI | InChI=1S/C22H20ClNO3/c1-15-4-6-16(7-5-15)14-19-20(25)24(18-10-8-17(23)9-11-18)21(26)22(19)12-2-3-13-27-22/h4-11,14H,2-3,12-13H2,1H3/b19-14- |
| InChIKey | DFHXQTSBWIBRSO-RGEXLXHISA-N |
| XLogP | 4.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|