C23H20F3NO3 — CID 171340608
2-(4-methylphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-6-oxa-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 171340608) has the molecular formula C23H20F3NO3 and a molecular weight of 415.41 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-6-oxa-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | 2-(4-methylphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-6-oxa-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 171340608 |
| Molecular Formula | C23H20F3NO3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-(4-methylphenyl)-4-[[2-(trifluoromethyl)phenyl]methylidene]-6-oxa-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(=Cc3ccccc3C(F)(F)F)C3(CCCCO3)C2=O)cc1 |
| InChI | InChI=1S/C23H20F3NO3/c1-15-8-10-17(11-9-15)27-20(28)19(22(21(27)29)12-4-5-13-30-22)14-16-6-2-3-7-18(16)23(24,25)26/h2-3,6-11,14H,4-5,12-13H2,1H3 |
| InChIKey | KWPYTWXTZPTWEW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|