C21H18FNO3 — CID 170912994
(4E)-4-[(4-fluorophenyl)methylidene]-2-phenyl-6-oxa-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 170912994) has the molecular formula C21H18FNO3 and a molecular weight of 351.38 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)methylidene]-2-phenyl-6-oxa-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | (4E)-4-[(4-fluorophenyl)methylidene]-2-phenyl-6-oxa-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 170912994 |
| Molecular Formula | C21H18FNO3 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)methylidene]-2-phenyl-6-oxa-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | O=C1/C(=C/c2ccc(F)cc2)C2(CCCCO2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H18FNO3/c22-16-10-8-15(9-11-16)14-18-19(24)23(17-6-2-1-3-7-17)20(25)21(18)12-4-5-13-26-21/h1-3,6-11,14H,4-5,12-13H2/b18-14- |
| InChIKey | KWWURHPTIMFLIN-JXAWBTAJSA-N |
| XLogP | 3.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|