C17H26N8O3S — CID 171353198
8-cyclopentyl-2-hydrazinyl-6-[(1-methylsulfonylpiperidin-4-yl)amino]pteridin-7-one (PubChem CID 171353198) has the molecular formula C17H26N8O3S and a molecular weight of 422.52 g/mol. Its IUPAC name is 8-cyclopentyl-2-hydrazinyl-6-[(1-methylsulfonylpiperidin-4-yl)amino]pteridin-7-one.
| Compound Name | 8-cyclopentyl-2-hydrazinyl-6-[(1-methylsulfonylpiperidin-4-yl)amino]pteridin-7-one |
|---|---|
| PubChem CID | 171353198 |
| Molecular Formula | C17H26N8O3S |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 8-cyclopentyl-2-hydrazinyl-6-[(1-methylsulfonylpiperidin-4-yl)amino]pteridin-7-one |
| SMILES | CS(=O)(=O)N1CCC(Nc2nc3cnc(NN)nc3n(C3CCCC3)c2=O)CC1 |
| InChI | InChI=1S/C17H26N8O3S/c1-29(27,28)24-8-6-11(7-9-24)20-14-16(26)25(12-4-2-3-5-12)15-13(21-14)10-19-17(22-15)23-18/h10-12H,2-9,18H2,1H3,(H,20,21)(H,19,22,23) |
| InChIKey | MHCLIVKNZRFELU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|