C25H44N4O4 — CID 171365950
11,19-dimethyl-1-oxa-12,13,17,18-tetrazacyclooctacosa-11,18-diene-2,14,16-trione (PubChem CID 171365950) has the molecular formula C25H44N4O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is 11,19-dimethyl-1-oxa-12,13,17,18-tetrazacyclooctacosa-11,18-diene-2,14,16-trione.
| Compound Name | 11,19-dimethyl-1-oxa-12,13,17,18-tetrazacyclooctacosa-11,18-diene-2,14,16-trione |
|---|---|
| PubChem CID | 171365950 |
| Molecular Formula | C25H44N4O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | 11,19-dimethyl-1-oxa-12,13,17,18-tetrazacyclooctacosa-11,18-diene-2,14,16-trione |
| SMILES | CC1=NNC(=O)CC(=O)NN=C(C)CCCCCCCCC(=O)OCCCCCCCCC1 |
| InChI | InChI=1S/C25H44N4O4/c1-21-16-12-8-4-3-7-11-15-19-33-25(32)18-14-10-6-5-9-13-17-22(2)27-29-24(31)20-23(30)28-26-21/h3-20H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | MWTAEALLIDGZRB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|