C6H10O — CID 171391309
1,1,2-trideuteriohex-1-en-3-one (PubChem CID 171391309) has the molecular formula C6H10O and a molecular weight of 101.16 g/mol. Its IUPAC name is 1,1,2-trideuteriohex-1-en-3-one.
| Compound Name | 1,1,2-trideuteriohex-1-en-3-one |
|---|---|
| PubChem CID | 171391309 |
| Molecular Formula | C6H10O |
| Molecular Weight | 101.16 g/mol |
| Exact Mass | 101.09 |
| IUPAC Name | 1,1,2-trideuteriohex-1-en-3-one |
| SMILES | [2H]C([2H])=C([2H])C(=O)CCC |
| InChI | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h4H,2-3,5H2,1H3/i2D2,4D |
| InChIKey | JTHNLKXLWOXOQK-OVLJBECYSA-N |
| XLogP | 1.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|