C24H15ClFNO — CID 171404731
5-chloro-2-(6-fluorodibenzofuran-4-yl)-4-[2-(trideuteriomethyl)phenyl]pyridine (PubChem CID 171404731) has the molecular formula C24H15ClFNO and a molecular weight of 390.86 g/mol. Its IUPAC name is 5-chloro-2-(6-fluorodibenzofuran-4-yl)-4-[2-(trideuteriomethyl)phenyl]pyridine.
| Compound Name | 5-chloro-2-(6-fluorodibenzofuran-4-yl)-4-[2-(trideuteriomethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 171404731 |
| Molecular Formula | C24H15ClFNO |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 5-chloro-2-(6-fluorodibenzofuran-4-yl)-4-[2-(trideuteriomethyl)phenyl]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccccc1-c1cc(-c2cccc3c2oc2c(F)cccc23)ncc1Cl |
| InChI | InChI=1S/C24H15ClFNO/c1-14-6-2-3-7-15(14)19-12-22(27-13-20(19)25)18-10-4-8-16-17-9-5-11-21(26)24(17)28-23(16)18/h2-13H,1H3/i1D3 |
| InChIKey | HRVRIQZJYPGYOS-FIBGUPNXSA-N |
| XLogP | 7.42 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |