C42H77NOS — CID 171420546
3-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]sulfanyl-N,N-dimethylpropanamide (PubChem CID 171420546) has the molecular formula C42H77NOS and a molecular weight of 644.15 g/mol. Its IUPAC name is 3-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]sulfanyl-N,N-dimethylpropanamide.
| Compound Name | 3-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]sulfanyl-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 171420546 |
| Molecular Formula | C42H77NOS |
| Molecular Weight | 644.15 g/mol |
| Exact Mass | 643.57 |
| IUPAC Name | 3-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]sulfanyl-N,N-dimethylpropanamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)SCCC(=O)N(C)C |
| InChI | InChI=1S/C42H77NOS/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(45-40-39-42(44)43(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,41H,5-12,17-18,23-40H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | FLMVVDMWNPEVDE-KWXKLSQISA-N |
| XLogP | 13.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.15 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|