About carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium)
carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium) (PubChem CID 171424214) has the molecular formula C7H16OY2-2
and a molecular weight of 294.02 g/mol. Its IUPAC name is carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium).
Molecular Properties
| Compound Name | carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium) |
| PubChem CID | 171424214 |
| Molecular Formula | C7H16OY2-2 |
| Molecular Weight | 294.02 g/mol |
| Exact Mass | 293.93 |
| IUPAC Name | carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium) |
| SMILES | [CH2-][C@H](C)CCCO.[CH3-].[Y].[Y] |
| InChI | InChI=1S/C6H13O.CH3.2Y/c1-6(2)4-3-5-7;;;/h6-7H,1,3-5H2,2H3;1H3;;/q2*-1;;/t6-;;;/m1.../s1 |
| InChIKey | BAZGHQOJBJLCJY-VMESQJNGSA-N |
| XLogP | 1.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.02 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium)?
The IUPAC name of carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium) (CID 171424214) is carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium).
What is the SMILES notation for carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium)?
The canonical SMILES for carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium) is [CH2-][C@H](C)CCCO.[CH3-].[Y].[Y].
What is the InChIKey of carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium)?
The InChIKey is BAZGHQOJBJLCJY-VMESQJNGSA-N. The full InChI is InChI=1S/C6H13O.CH3.2Y/c1-6(2)4-3-5-7;;;/h6-7H,1,3-5H2,2H3;1H3;;/q2*-1;;/t6-;;;/m1.../s1.
What are the key properties of carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium)?
carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium) has a molecular weight of 294.02 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(4R)-4-methanidylpentan-1-ol;bis(yttrium) is sourced from PubChem (CID 171424214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).