About carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+)
carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+) (PubChem CID 171424303) has the molecular formula C8H17Y2
and a molecular weight of 291.04 g/mol. Its IUPAC name is carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+).
Molecular Properties
| Compound Name | carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+) |
| PubChem CID | 171424303 |
| Molecular Formula | C8H17Y2 |
| Molecular Weight | 291.04 g/mol |
| Exact Mass | 290.94 |
| IUPAC Name | carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+) |
| SMILES | [CH2-]CCC[C@H]([CH2-])C.[CH3-].[Y+3].[Y] |
| InChI | InChI=1S/C7H14.CH3.2Y/c1-4-5-6-7(2)3;;;/h7H,1-2,4-6H2,3H3;1H3;;/q-2;-1;;+3/t7-;;;/m1.../s1 |
| InChIKey | AHALSCCSENWKJS-LSBIWMFESA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.04 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+)?
The IUPAC name of carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+) (CID 171424303) is carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+).
What is the SMILES notation for carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+)?
The canonical SMILES for carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+) is [CH2-]CCC[C@H]([CH2-])C.[CH3-].[Y+3].[Y].
What is the InChIKey of carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+)?
The InChIKey is AHALSCCSENWKJS-LSBIWMFESA-N. The full InChI is InChI=1S/C7H14.CH3.2Y/c1-4-5-6-7(2)3;;;/h7H,1-2,4-6H2,3H3;1H3;;/q-2;-1;;+3/t7-;;;/m1.../s1.
What are the key properties of carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+)?
carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+) has a molecular weight of 291.04 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(2R)-2-methanidylhexane;yttrium;yttrium(3+) is sourced from PubChem (CID 171424303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).