C28H36F14O9 — CID 171444399
1-[2,2,3,3-tetrafluoro-3-[1,1,2,2,3,3-hexafluoro-3-[1,1,2,2-tetrafluoro-3-[2-hydroxy-3-(4-methoxyphenoxy)propoxy]propoxy]propoxy]propoxy]nonane-2,7-diol (PubChem CID 171444399) has the molecular formula C28H36F14O9 and a molecular weight of 782.56 g/mol. Its IUPAC name is 1-[2,2,3,3-tetrafluoro-3-[1,1,2,2,3,3-hexafluoro-3-[1,1,2,2-tetrafluoro-3-[2-hydroxy-3-(4-methoxyphenoxy)propoxy]propoxy]propoxy]propoxy]nonane-2,7-diol.
| Compound Name | 1-[2,2,3,3-tetrafluoro-3-[1,1,2,2,3,3-hexafluoro-3-[1,1,2,2-tetrafluoro-3-[2-hydroxy-3-(4-methoxyphenoxy)propoxy]propoxy]propoxy]propoxy]nonane-2,7-diol |
|---|---|
| PubChem CID | 171444399 |
| Molecular Formula | C28H36F14O9 |
| Molecular Weight | 782.56 g/mol |
| Exact Mass | 782.21 |
| IUPAC Name | 1-[2,2,3,3-tetrafluoro-3-[1,1,2,2,3,3-hexafluoro-3-[1,1,2,2-tetrafluoro-3-[2-hydroxy-3-(4-methoxyphenoxy)propoxy]propoxy]propoxy]propoxy]nonane-2,7-diol |
| SMILES | CCC(O)CCCCC(O)COCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)COCC(O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H36F14O9/c1-3-17(43)6-4-5-7-18(44)12-47-15-22(29,30)25(35,36)50-27(39,40)24(33,34)28(41,42)51-26(37,38)23(31,32)16-48-13-19(45)14-49-21-10-8-20(46-2)9-11-21/h8-11,17-19,43-45H,3-7,12-16H2,1-2H3 |
| InChIKey | MEWITKBMNKEQDR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|