C20H16ClF2N — CID 171448905
4-chloro-3,5-difluoro-N,N-bis(4-methylphenyl)aniline (PubChem CID 171448905) has the molecular formula C20H16ClF2N and a molecular weight of 343.80 g/mol. Its IUPAC name is 4-chloro-3,5-difluoro-N,N-bis(4-methylphenyl)aniline.
| Compound Name | 4-chloro-3,5-difluoro-N,N-bis(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 171448905 |
| Molecular Formula | C20H16ClF2N |
| Molecular Weight | 343.80 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-chloro-3,5-difluoro-N,N-bis(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2cc(F)c(Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C20H16ClF2N/c1-13-3-7-15(8-4-13)24(16-9-5-14(2)6-10-16)17-11-18(22)20(21)19(23)12-17/h3-12H,1-2H3 |
| InChIKey | WXDMMNNWHHOZEH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.80 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|