C14H10ClNO2 — CID 171471439
6-chloro-3-(2-methoxyphenyl)furo[3,2-b]pyridine (PubChem CID 171471439) has the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. Its IUPAC name is 6-chloro-3-(2-methoxyphenyl)furo[3,2-b]pyridine.
| Compound Name | 6-chloro-3-(2-methoxyphenyl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 171471439 |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 6-chloro-3-(2-methoxyphenyl)furo[3,2-b]pyridine |
| SMILES | COc1ccccc1-c1coc2cc(Cl)cnc12 |
| InChI | InChI=1S/C14H10ClNO2/c1-17-12-5-3-2-4-10(12)11-8-18-13-6-9(15)7-16-14(11)13/h2-8H,1H3 |
| InChIKey | JTFPPDDSLZXDDI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |