C14H7ClN2O — CID 171512486
2-(6-chlorofuro[3,2-b]pyridin-3-yl)benzonitrile (PubChem CID 171512486) has the molecular formula C14H7ClN2O and a molecular weight of 254.68 g/mol. Its IUPAC name is 2-(6-chlorofuro[3,2-b]pyridin-3-yl)benzonitrile.
| Compound Name | 2-(6-chlorofuro[3,2-b]pyridin-3-yl)benzonitrile |
|---|---|
| PubChem CID | 171512486 |
| Molecular Formula | C14H7ClN2O |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 2-(6-chlorofuro[3,2-b]pyridin-3-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1coc2cc(Cl)cnc12 |
| InChI | InChI=1S/C14H7ClN2O/c15-10-5-13-14(17-7-10)12(8-18-13)11-4-2-1-3-9(11)6-16/h1-5,7-8H |
| InChIKey | ZJSBJXFKYKKGTH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |