C30H31N5O8 — CID 171472126
[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] (2S)-2-acetamido-5-amino-5-oxopentanoate (PubChem CID 171472126) has the molecular formula C30H31N5O8 and a molecular weight of 589.61 g/mol. Its IUPAC name is [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] (2S)-2-acetamido-5-amino-5-oxopentanoate.
| Compound Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] (2S)-2-acetamido-5-amino-5-oxopentanoate |
|---|---|
| PubChem CID | 171472126 |
| Molecular Formula | C30H31N5O8 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] (2S)-2-acetamido-5-amino-5-oxopentanoate |
| SMILES | CC(=O)N[C@@H](CCC(N)=O)C(=O)Oc1ccc2c(c1)OC(C)(C)C1=CCn3c(=O)n(-c4ccc(C(C)=O)cc4)c(=O)n3C12 |
| InChI | InChI=1S/C30H31N5O8/c1-16(36)18-5-7-19(8-6-18)34-28(40)33-14-13-22-26(35(33)29(34)41)21-10-9-20(15-24(21)43-30(22,3)4)42-27(39)23(32-17(2)37)11-12-25(31)38/h5-10,13,15,23,26H,11-12,14H2,1-4H3,(H2,31,38)(H,32,37)/t23-,26?/m0/s1 |
| InChIKey | OKPKDKNXXNEVCV-ZZHFZYNASA-N |
| XLogP | 1.38 |
| TPSA | 173.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|