C29H32N4O7 — CID 171482800
4-[[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]oxy]-2-(dimethylamino)butanoic acid (PubChem CID 171482800) has the molecular formula C29H32N4O7 and a molecular weight of 548.60 g/mol. Its IUPAC name is 4-[[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]oxy]-2-(dimethylamino)butanoic acid.
| Compound Name | 4-[[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]oxy]-2-(dimethylamino)butanoic acid |
|---|---|
| PubChem CID | 171482800 |
| Molecular Formula | C29H32N4O7 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 4-[[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]oxy]-2-(dimethylamino)butanoic acid |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3cc(OCCC(C(=O)O)N(C)C)ccc32)cc1 |
| InChI | InChI=1S/C29H32N4O7/c1-17(34)18-6-8-19(9-7-18)32-27(37)31-14-12-22-25(33(31)28(32)38)21-11-10-20(16-24(21)40-29(22,2)3)39-15-13-23(26(35)36)30(4)5/h6-12,16,23,25H,13-15H2,1-5H3,(H,35,36) |
| InChIKey | HHNYNGZMBKQQJN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|