C30H31F3N4O8 — CID 174236766
[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid (PubChem CID 174236766) has the molecular formula C30H31F3N4O8 and a molecular weight of 632.59 g/mol. Its IUPAC name is [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174236766 |
| Molecular Formula | C30H31F3N4O8 |
| Molecular Weight | 632.59 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2-amino-3-methylbutanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3cc(OC(=O)C(N)C(C)C)ccc32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H30N4O6.C2HF3O2/c1-15(2)23(29)25(34)37-19-10-11-20-22(14-19)38-28(4,5)21-12-13-30-26(35)31(27(36)32(30)24(20)21)18-8-6-17(7-9-18)16(3)33;3-2(4,5)1(6)7/h6-12,14-15,23-24H,13,29H2,1-5H3;(H,6,7) |
| InChIKey | UQDHRKLXAMTLGH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 164.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|