C27H29ClN4O6 — CID 166457736
[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2-(dimethylamino)acetate;hydrochloride (PubChem CID 166457736) has the molecular formula C27H29ClN4O6 and a molecular weight of 541.00 g/mol. Its IUPAC name is [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2-(dimethylamino)acetate;hydrochloride.
| Compound Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2-(dimethylamino)acetate;hydrochloride |
|---|---|
| PubChem CID | 166457736 |
| Molecular Formula | C27H29ClN4O6 |
| Molecular Weight | 541.00 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 2-(dimethylamino)acetate;hydrochloride |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3cc(OC(=O)CN(C)C)ccc32)cc1.Cl |
| InChI | InChI=1S/C27H28N4O6.ClH/c1-16(32)17-6-8-18(9-7-17)30-25(34)29-13-12-21-24(31(29)26(30)35)20-11-10-19(36-23(33)15-28(4)5)14-22(20)37-27(21,2)3;/h6-12,14,24H,13,15H2,1-5H3;1H |
| InChIKey | TYOKKEWVWYXVSQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.00 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|