C12H13NO — CID 171482237
1,2,3,4,5,7-hexahydroazuleno[1,2-b]pyrrol-6-one (PubChem CID 171482237) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1,2,3,4,5,7-hexahydroazuleno[1,2-b]pyrrol-6-one.
| Compound Name | 1,2,3,4,5,7-hexahydroazuleno[1,2-b]pyrrol-6-one |
|---|---|
| PubChem CID | 171482237 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1,2,3,4,5,7-hexahydroazuleno[1,2-b]pyrrol-6-one |
| SMILES | O=C1CC=CC2=C(C1)CC1=C2NCC1 |
| InChI | InChI=1S/C12H13NO/c14-10-2-1-3-11-9(7-10)6-8-4-5-13-12(8)11/h1,3,13H,2,4-7H2 |
| InChIKey | CZWSWLGFSJBJHX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |