C28H30ClN5O6 — CID 171482771
2-[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]piperazine-1-carboxylic acid;hydrochloride (PubChem CID 171482771) has the molecular formula C28H30ClN5O6 and a molecular weight of 568.03 g/mol. Its IUPAC name is 2-[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]piperazine-1-carboxylic acid;hydrochloride.
| Compound Name | 2-[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]piperazine-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 171482771 |
| Molecular Formula | C28H30ClN5O6 |
| Molecular Weight | 568.03 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 2-[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]piperazine-1-carboxylic acid;hydrochloride |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3cc(C4CNCCN4C(=O)O)ccc32)cc1.Cl |
| InChI | InChI=1S/C28H29N5O6.ClH/c1-16(34)17-4-7-19(8-5-17)32-25(35)31-12-10-21-24(33(31)26(32)36)20-9-6-18(14-23(20)39-28(21,2)3)22-15-29-11-13-30(22)27(37)38;/h4-10,14,22,24,29H,11-13,15H2,1-3H3,(H,37,38);1H |
| InChIKey | GUCDZOWEVWUGQS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.03 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|