C28H36F2N2O5 — CID 171523856
tert-butyl (5R)-3,3-difluoro-5-[phenylmethoxycarbonyl(3-phenylmethoxypropyl)amino]piperidine-1-carboxylate (PubChem CID 171523856) has the molecular formula C28H36F2N2O5 and a molecular weight of 518.60 g/mol. Its IUPAC name is tert-butyl (5R)-3,3-difluoro-5-[phenylmethoxycarbonyl(3-phenylmethoxypropyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-3,3-difluoro-5-[phenylmethoxycarbonyl(3-phenylmethoxypropyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171523856 |
| Molecular Formula | C28H36F2N2O5 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | tert-butyl (5R)-3,3-difluoro-5-[phenylmethoxycarbonyl(3-phenylmethoxypropyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(CCCOCc2ccccc2)C(=O)OCc2ccccc2)CC(F)(F)C1 |
| InChI | InChI=1S/C28H36F2N2O5/c1-27(2,3)37-25(33)31-18-24(17-28(29,30)21-31)32(26(34)36-20-23-13-8-5-9-14-23)15-10-16-35-19-22-11-6-4-7-12-22/h4-9,11-14,24H,10,15-21H2,1-3H3/t24-/m1/s1 |
| InChIKey | TUAPKJJRZVGPAI-XMMPIXPASA-N |
| XLogP | 5.88 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|