C26H30ClN3O3S — CID 171536175
6-chloro-4-hydroxy-3-[[4-(5-hydroxypentyl)phenyl]methyl]-4-phenyl-1H-quinazolin-2-one;thiohydroxylamine (PubChem CID 171536175) has the molecular formula C26H30ClN3O3S and a molecular weight of 500.06 g/mol. Its IUPAC name is 6-chloro-4-hydroxy-3-[[4-(5-hydroxypentyl)phenyl]methyl]-4-phenyl-1H-quinazolin-2-one;thiohydroxylamine.
| Compound Name | 6-chloro-4-hydroxy-3-[[4-(5-hydroxypentyl)phenyl]methyl]-4-phenyl-1H-quinazolin-2-one;thiohydroxylamine |
|---|---|
| PubChem CID | 171536175 |
| Molecular Formula | C26H30ClN3O3S |
| Molecular Weight | 500.06 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 6-chloro-4-hydroxy-3-[[4-(5-hydroxypentyl)phenyl]methyl]-4-phenyl-1H-quinazolin-2-one;thiohydroxylamine |
| SMILES | NS.O=C1Nc2ccc(Cl)cc2C(O)(c2ccccc2)N1Cc1ccc(CCCCCO)cc1 |
| InChI | InChI=1S/C26H27ClN2O3.H3NS/c27-22-14-15-24-23(17-22)26(32,21-8-4-1-5-9-21)29(25(31)28-24)18-20-12-10-19(11-13-20)7-3-2-6-16-30;1-2/h1,4-5,8-15,17,30,32H,2-3,6-7,16,18H2,(H,28,31);2H,1H2 |
| InChIKey | XDFUHQADLAUENC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.06 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|