C19H22FNO5S2 — CID 171543046
[(3R)-4-(4-fluorophenyl)sulfanyl-3-(phenylmethoxycarbonylamino)butyl] methanesulfonate (PubChem CID 171543046) has the molecular formula C19H22FNO5S2 and a molecular weight of 427.52 g/mol. Its IUPAC name is [(3R)-4-(4-fluorophenyl)sulfanyl-3-(phenylmethoxycarbonylamino)butyl] methanesulfonate.
| Compound Name | [(3R)-4-(4-fluorophenyl)sulfanyl-3-(phenylmethoxycarbonylamino)butyl] methanesulfonate |
|---|---|
| PubChem CID | 171543046 |
| Molecular Formula | C19H22FNO5S2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | [(3R)-4-(4-fluorophenyl)sulfanyl-3-(phenylmethoxycarbonylamino)butyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@H](CSc1ccc(F)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H22FNO5S2/c1-28(23,24)26-12-11-17(14-27-18-9-7-16(20)8-10-18)21-19(22)25-13-15-5-3-2-4-6-15/h2-10,17H,11-14H2,1H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | WLIWIHZCPBJMIB-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|