C26H29N7O3 — CID 171547163
16-ethynyl-6-[4-(2-methoxyethyl)piperazin-1-yl]-2,8,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-9,14-dione (PubChem CID 171547163) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is 16-ethynyl-6-[4-(2-methoxyethyl)piperazin-1-yl]-2,8,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-9,14-dione.
| Compound Name | 16-ethynyl-6-[4-(2-methoxyethyl)piperazin-1-yl]-2,8,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-9,14-dione |
|---|---|
| PubChem CID | 171547163 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 16-ethynyl-6-[4-(2-methoxyethyl)piperazin-1-yl]-2,8,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-9,14-dione |
| SMILES | C#Cc1cc(=O)n2c3nc(ncc13)Nc1ccc(N3CCN(CCOC)CC3)c(c1)NC(=O)CCC2 |
| InChI | InChI=1S/C26H29N7O3/c1-3-18-15-24(35)33-8-4-5-23(34)29-21-16-19(28-26-27-17-20(18)25(33)30-26)6-7-22(21)32-11-9-31(10-12-32)13-14-36-2/h1,6-7,15-17H,4-5,8-14H2,2H3,(H,29,34)(H,27,28,30) |
| InChIKey | NZMOANYCLYTEJD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|