C24H25N7O2 — CID 171546903
16-ethynyl-6-(4-methylpiperazin-1-yl)-2,10,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-11,14-dione (PubChem CID 171546903) has the molecular formula C24H25N7O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 16-ethynyl-6-(4-methylpiperazin-1-yl)-2,10,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-11,14-dione.
| Compound Name | 16-ethynyl-6-(4-methylpiperazin-1-yl)-2,10,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-11,14-dione |
|---|---|
| PubChem CID | 171546903 |
| Molecular Formula | C24H25N7O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 16-ethynyl-6-(4-methylpiperazin-1-yl)-2,10,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-11,14-dione |
| SMILES | C#Cc1cc(=O)n2c3nc(ncc13)Nc1ccc(N3CCN(C)CC3)c(c1)CCNC(=O)C2 |
| InChI | InChI=1S/C24H25N7O2/c1-3-16-13-22(33)31-15-21(32)25-7-6-17-12-18(27-24-26-14-19(16)23(31)28-24)4-5-20(17)30-10-8-29(2)9-11-30/h1,4-5,12-14H,6-11,15H2,2H3,(H,25,32)(H,26,27,28) |
| InChIKey | GCAVLCHBTFJTBD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|