C25H27N7O2 — CID 171547250
16-ethynyl-6-(4-methyl-1,4-diazepan-1-yl)-2,8,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-9,14-dione (PubChem CID 171547250) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 16-ethynyl-6-(4-methyl-1,4-diazepan-1-yl)-2,8,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-9,14-dione.
| Compound Name | 16-ethynyl-6-(4-methyl-1,4-diazepan-1-yl)-2,8,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-9,14-dione |
|---|---|
| PubChem CID | 171547250 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 16-ethynyl-6-(4-methyl-1,4-diazepan-1-yl)-2,8,13,19,20-pentazatetracyclo[11.6.2.13,7.017,21]docosa-1(19),3(22),4,6,15,17,20-heptaene-9,14-dione |
| SMILES | C#Cc1cc(=O)n2c3nc(ncc13)Nc1ccc(N3CCCN(C)CC3)c(c1)NC(=O)CCC2 |
| InChI | InChI=1S/C25H27N7O2/c1-3-17-14-23(34)32-11-4-6-22(33)28-20-15-18(27-25-26-16-19(17)24(32)29-25)7-8-21(20)31-10-5-9-30(2)12-13-31/h1,7-8,14-16H,4-6,9-13H2,2H3,(H,28,33)(H,26,27,29) |
| InChIKey | MTLZBYRCHQTAHB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|