C19H21F3N4O3 — CID 171556638
(2R,3R,4R,5S)-2-(1,3-dihydroisoindol-2-ylmethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171556638) has the molecular formula C19H21F3N4O3 and a molecular weight of 410.40 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(1,3-dihydroisoindol-2-ylmethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(1,3-dihydroisoindol-2-ylmethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171556638 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (2R,3R,4R,5S)-2-(1,3-dihydroisoindol-2-ylmethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)CO[C@@H]1CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C19H21F3N4O3/c20-19(21,22)15-5-23-6-16(25-15)24-13-10-29-14(18(28)17(13)27)9-26-7-11-3-1-2-4-12(11)8-26/h1-6,13-14,17-18,27-28H,7-10H2,(H,24,25)/t13-,14+,17+,18-/m0/s1 |
| InChIKey | BYFDVVQXXWLNDG-JFTQMJAMSA-N |
| XLogP | 1.41 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |