C16H16F3N3O3S — CID 171556968
(3S,4R,5R,6R)-6-(4-sulfanylphenyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171556968) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is (3S,4R,5R,6R)-6-(4-sulfanylphenyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (3S,4R,5R,6R)-6-(4-sulfanylphenyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171556968 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (3S,4R,5R,6R)-6-(4-sulfanylphenyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Nc2cncc(C(F)(F)F)n2)[C@@H](c2ccc(S)cc2)OC[C@@H]1O |
| InChI | InChI=1S/C16H16F3N3O3S/c17-16(18,19)11-5-20-6-12(21-11)22-13-14(24)10(23)7-25-15(13)8-1-3-9(26)4-2-8/h1-6,10,13-15,23-24,26H,7H2,(H,21,22)/t10-,13+,14-,15+/m0/s1 |
| InChIKey | GXVPUTQFLQLGCY-OADPDTJPSA-N |
| XLogP | 2.06 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|