C22H24ClN5O4 — CID 171557668
benzyl (3aS,7S,7aR)-7-[(2-chloropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 171557668) has the molecular formula C22H24ClN5O4 and a molecular weight of 457.92 g/mol. Its IUPAC name is benzyl (3aS,7S,7aR)-7-[(2-chloropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (3aS,7S,7aR)-7-[(2-chloropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 171557668 |
| Molecular Formula | C22H24ClN5O4 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | benzyl (3aS,7S,7aR)-7-[(2-chloropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC1(C)O[C@@H]2[C@@H](Nc3nc(Cl)nn4cccc34)CN(C(=O)OCc3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C22H24ClN5O4/c1-22(2)31-17-12-27(21(29)30-13-14-7-4-3-5-8-14)11-15(18(17)32-22)24-19-16-9-6-10-28(16)26-20(23)25-19/h3-10,15,17-18H,11-13H2,1-2H3,(H,24,25,26)/t15-,17-,18+/m0/s1 |
| InChIKey | GMUMPPVFSGIMQT-RYQLBKOJSA-N |
| XLogP | 3.34 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |