C19H20ClN5O4 — CID 171557952
benzyl (3S,4R,5S)-3-[(2-chloropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-4,5-dihydroxypiperidine-1-carboxylate (PubChem CID 171557952) has the molecular formula C19H20ClN5O4 and a molecular weight of 417.85 g/mol. Its IUPAC name is benzyl (3S,4R,5S)-3-[(2-chloropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-4,5-dihydroxypiperidine-1-carboxylate.
| Compound Name | benzyl (3S,4R,5S)-3-[(2-chloropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-4,5-dihydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 171557952 |
| Molecular Formula | C19H20ClN5O4 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | benzyl (3S,4R,5S)-3-[(2-chloropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]-4,5-dihydroxypiperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H](Nc2nc(Cl)nn3cccc23)[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C19H20ClN5O4/c20-18-22-17(14-7-4-8-25(14)23-18)21-13-9-24(10-15(26)16(13)27)19(28)29-11-12-5-2-1-3-6-12/h1-8,13,15-16,26-27H,9-11H2,(H,21,22,23)/t13-,15-,16+/m0/s1 |
| InChIKey | MCQFVQGZJUPGRN-CWRNSKLLSA-N |
| XLogP | 1.54 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |