C20H30F3N5O6 — CID 171558814
N-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-2-[2-(2-aminoethoxy)ethoxy]acetamide (PubChem CID 171558814) has the molecular formula C20H30F3N5O6 and a molecular weight of 493.48 g/mol. Its IUPAC name is N-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-2-[2-(2-aminoethoxy)ethoxy]acetamide.
| Compound Name | N-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-2-[2-(2-aminoethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 171558814 |
| Molecular Formula | C20H30F3N5O6 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-2-[2-(2-aminoethoxy)ethoxy]acetamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cncc(C(F)(F)F)n1)CO[C@@H]2CNC(=O)COCCOCCN |
| InChI | InChI=1S/C20H30F3N5O6/c1-19(2)33-17-12(27-15-9-25-8-14(28-15)20(21,22)23)10-32-13(18(17)34-19)7-26-16(29)11-31-6-5-30-4-3-24/h8-9,12-13,17-18H,3-7,10-11,24H2,1-2H3,(H,26,29)(H,27,28)/t12-,13+,17+,18-/m0/s1 |
| InChIKey | LGRQMDYZUHWJAL-DECQCQTCSA-N |
| XLogP | 0.30 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|