C17H17N3O5 — CID 171588231
8-amino-2-[(3S)-2,6-dioxopiperidin-3-yl]-6-methoxy-6,7-dihydro-5H-cyclopenta[f]isoindole-1,3-dione (PubChem CID 171588231) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 8-amino-2-[(3S)-2,6-dioxopiperidin-3-yl]-6-methoxy-6,7-dihydro-5H-cyclopenta[f]isoindole-1,3-dione.
| Compound Name | 8-amino-2-[(3S)-2,6-dioxopiperidin-3-yl]-6-methoxy-6,7-dihydro-5H-cyclopenta[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171588231 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 8-amino-2-[(3S)-2,6-dioxopiperidin-3-yl]-6-methoxy-6,7-dihydro-5H-cyclopenta[f]isoindole-1,3-dione |
| SMILES | COC1Cc2cc3c(c(N)c2C1)C(=O)N([C@H]1CCC(=O)NC1=O)C3=O |
| InChI | InChI=1S/C17H17N3O5/c1-25-8-4-7-5-10-13(14(18)9(7)6-8)17(24)20(16(10)23)11-2-3-12(21)19-15(11)22/h5,8,11H,2-4,6,18H2,1H3,(H,19,21,22)/t8?,11-/m0/s1 |
| InChIKey | CCVMXRZZIWJFJR-LYNSQETBSA-N |
| XLogP | -0.22 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|