C34H21ClS — CID 171588864
1-[4-(3-chloronaphthalen-1-yl)-2-phenylphenyl]-2,3,4,6,7,8,9-heptadeuteriodibenzothiophene (PubChem CID 171588864) has the molecular formula C34H21ClS and a molecular weight of 504.10 g/mol. Its IUPAC name is 1-[4-(3-chloronaphthalen-1-yl)-2-phenylphenyl]-2,3,4,6,7,8,9-heptadeuteriodibenzothiophene.
| Compound Name | 1-[4-(3-chloronaphthalen-1-yl)-2-phenylphenyl]-2,3,4,6,7,8,9-heptadeuteriodibenzothiophene |
|---|---|
| PubChem CID | 171588864 |
| Molecular Formula | C34H21ClS |
| Molecular Weight | 504.10 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 1-[4-(3-chloronaphthalen-1-yl)-2-phenylphenyl]-2,3,4,6,7,8,9-heptadeuteriodibenzothiophene |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c([2H])c([2H])c(-c4ccc(-c5cc(Cl)cc6ccccc56)cc4-c4ccccc4)c32)c1[2H] |
| InChI | InChI=1S/C34H21ClS/c35-25-19-23-11-4-5-12-26(23)31(21-25)24-17-18-27(30(20-24)22-9-2-1-3-10-22)28-14-8-16-33-34(28)29-13-6-7-15-32(29)36-33/h1-21H/i6D,7D,8D,13D,14D,15D,16D |
| InChIKey | ULIXCVDBQXTCKP-NZWFZQGGSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.10 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |