C18H11ClS — CID 177107425
3-chloro-1,2,4,6,7,8-hexadeuterio-9-phenyldibenzothiophene (PubChem CID 177107425) has the molecular formula C18H11ClS and a molecular weight of 300.84 g/mol. Its IUPAC name is 3-chloro-1,2,4,6,7,8-hexadeuterio-9-phenyldibenzothiophene.
| Compound Name | 3-chloro-1,2,4,6,7,8-hexadeuterio-9-phenyldibenzothiophene |
|---|---|
| PubChem CID | 177107425 |
| Molecular Formula | C18H11ClS |
| Molecular Weight | 300.84 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-chloro-1,2,4,6,7,8-hexadeuterio-9-phenyldibenzothiophene |
| SMILES | [2H]c1c([2H])c(-c2ccccc2)c2c(sc3c([2H])c(Cl)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C18H11ClS/c19-13-9-10-15-17(11-13)20-16-8-4-7-14(18(15)16)12-5-2-1-3-6-12/h1-11H/i4D,7D,8D,9D,10D,11D |
| InChIKey | BTLPBMCBGYZYEN-ZTDJJCDESA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.84 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |