C50H99NO4S — CID 171608288
7-[4-hydroxybutyl-(8-oxo-8-pentadecan-7-ylsulfanyloctyl)amino]heptyl 2-hexyldecanoate (PubChem CID 171608288) has the molecular formula C50H99NO4S and a molecular weight of 810.41 g/mol. Its IUPAC name is 7-[4-hydroxybutyl-(8-oxo-8-pentadecan-7-ylsulfanyloctyl)amino]heptyl 2-hexyldecanoate.
| Compound Name | 7-[4-hydroxybutyl-(8-oxo-8-pentadecan-7-ylsulfanyloctyl)amino]heptyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 171608288 |
| Molecular Formula | C50H99NO4S |
| Molecular Weight | 810.41 g/mol |
| Exact Mass | 809.73 |
| IUPAC Name | 7-[4-hydroxybutyl-(8-oxo-8-pentadecan-7-ylsulfanyloctyl)amino]heptyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)SC(=O)CCCCCCCN(CCCCO)CCCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C50H99NO4S/c1-5-9-13-17-21-28-38-47(37-27-15-11-7-3)50(54)55-46-36-26-20-25-33-43-51(44-34-35-45-52)42-32-24-19-23-31-41-49(53)56-48(39-29-16-12-8-4)40-30-22-18-14-10-6-2/h47-48,52H,5-46H2,1-4H3 |
| InChIKey | YJEFKNXTKIFFTG-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.41 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|