C36H42ClN3O4SSi — CID 171611020
8-[(1R)-1-[(2-benzylsulfanyl-6-chloro-3-pyridinyl)oxy]ethyl]-2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-4-yl]-3,6-dimethylchromen-4-one (PubChem CID 171611020) has the molecular formula C36H42ClN3O4SSi and a molecular weight of 676.36 g/mol. Its IUPAC name is 8-[(1R)-1-[(2-benzylsulfanyl-6-chloro-3-pyridinyl)oxy]ethyl]-2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-4-yl]-3,6-dimethylchromen-4-one.
| Compound Name | 8-[(1R)-1-[(2-benzylsulfanyl-6-chloro-3-pyridinyl)oxy]ethyl]-2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-4-yl]-3,6-dimethylchromen-4-one |
|---|---|
| PubChem CID | 171611020 |
| Molecular Formula | C36H42ClN3O4SSi |
| Molecular Weight | 676.36 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | 8-[(1R)-1-[(2-benzylsulfanyl-6-chloro-3-pyridinyl)oxy]ethyl]-2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazol-4-yl]-3,6-dimethylchromen-4-one |
| SMILES | Cc1cc([C@@H](C)Oc2ccc(Cl)nc2SCc2ccccc2)c2oc(-c3cnn(CCO[Si](C)(C)C(C)(C)C)c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C36H42ClN3O4SSi/c1-23-18-28(25(3)43-30-14-15-31(37)39-35(30)45-22-26-12-10-9-11-13-26)34-29(19-23)32(41)24(2)33(44-34)27-20-38-40(21-27)16-17-42-46(7,8)36(4,5)6/h9-15,18-21,25H,16-17,22H2,1-8H3/t25-/m1/s1 |
| InChIKey | UJIWJNJPNWWDOD-RUZDIDTESA-N |
| XLogP | 9.78 |
| TPSA | 79.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.36 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|