C9H20N2S — CID 171632782
2,4,4-trimethylpentan-2-yl carbamimidothioate (PubChem CID 171632782) has the molecular formula C9H20N2S and a molecular weight of 188.34 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yl carbamimidothioate.
| Compound Name | 2,4,4-trimethylpentan-2-yl carbamimidothioate |
|---|---|
| PubChem CID | 171632782 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yl carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C9H20N2S/c1-8(2,3)6-9(4,5)12-7(10)11/h6H2,1-5H3,(H3,10,11) |
| InChIKey | CBSCEAFTEMUMGW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|