C24H35BrClN3O7S — CID 171642277
N-[3-[2-[2-[3-[(7-bromo-5-chlorohept-6-ynoyl)amino]propoxy]ethoxy]ethoxy]propyl]-4-sulfamoylbenzamide (PubChem CID 171642277) has the molecular formula C24H35BrClN3O7S and a molecular weight of 624.98 g/mol. Its IUPAC name is N-[3-[2-[2-[3-[(7-bromo-5-chlorohept-6-ynoyl)amino]propoxy]ethoxy]ethoxy]propyl]-4-sulfamoylbenzamide.
| Compound Name | N-[3-[2-[2-[3-[(7-bromo-5-chlorohept-6-ynoyl)amino]propoxy]ethoxy]ethoxy]propyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 171642277 |
| Molecular Formula | C24H35BrClN3O7S |
| Molecular Weight | 624.98 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | N-[3-[2-[2-[3-[(7-bromo-5-chlorohept-6-ynoyl)amino]propoxy]ethoxy]ethoxy]propyl]-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCCCOCCOCCOCCCNC(=O)CCCC(Cl)C#CBr)cc1 |
| InChI | InChI=1S/C24H35BrClN3O7S/c25-11-10-21(26)4-1-5-23(30)28-12-2-14-34-16-18-36-19-17-35-15-3-13-29-24(31)20-6-8-22(9-7-20)37(27,32)33/h6-9,21H,1-5,12-19H2,(H,28,30)(H,29,31)(H2,27,32,33) |
| InChIKey | UHVRMPXGRPECAI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.98 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|