C6H16N4 — CID 171644196
(Z)-4-[amino(ethyl)amino]but-3-ene-1,3-diamine (PubChem CID 171644196) has the molecular formula C6H16N4 and a molecular weight of 144.22 g/mol. Its IUPAC name is (Z)-4-[amino(ethyl)amino]but-3-ene-1,3-diamine.
| Compound Name | (Z)-4-[amino(ethyl)amino]but-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 171644196 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | (Z)-4-[amino(ethyl)amino]but-3-ene-1,3-diamine |
| SMILES | CCN(N)/C=C(\N)CCN |
| InChI | InChI=1S/C6H16N4/c1-2-10(9)5-6(8)3-4-7/h5H,2-4,7-9H2,1H3/b6-5- |
| InChIKey | JINOLGNZBBPWPL-WAYWQWQTSA-N |
| XLogP | -0.67 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|