C16H11F3N4 — CID 171676136
8-(1-methylindol-4-yl)-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 171676136) has the molecular formula C16H11F3N4 and a molecular weight of 316.29 g/mol. Its IUPAC name is 8-(1-methylindol-4-yl)-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-(1-methylindol-4-yl)-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 171676136 |
| Molecular Formula | C16H11F3N4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 8-(1-methylindol-4-yl)-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cn1ccc2c(-c3cc(C(F)(F)F)cn4ncnc34)cccc21 |
| InChI | InChI=1S/C16H11F3N4/c1-22-6-5-12-11(3-2-4-14(12)22)13-7-10(16(17,18)19)8-23-15(13)20-9-21-23/h2-9H,1H3 |
| InChIKey | DALDVMMQRCKHQN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|