C28H26F3N3O4 — CID 171682908
2-(difluoromethoxy)-N-[4-[1-[3-(4-fluoroanilino)-3-oxopropanoyl]piperidin-4-yl]phenyl]benzamide (PubChem CID 171682908) has the molecular formula C28H26F3N3O4 and a molecular weight of 525.53 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[4-[1-[3-(4-fluoroanilino)-3-oxopropanoyl]piperidin-4-yl]phenyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[4-[1-[3-(4-fluoroanilino)-3-oxopropanoyl]piperidin-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 171682908 |
| Molecular Formula | C28H26F3N3O4 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 2-(difluoromethoxy)-N-[4-[1-[3-(4-fluoroanilino)-3-oxopropanoyl]piperidin-4-yl]phenyl]benzamide |
| SMILES | O=C(CC(=O)N1CCC(c2ccc(NC(=O)c3ccccc3OC(F)F)cc2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C28H26F3N3O4/c29-20-7-11-21(12-8-20)32-25(35)17-26(36)34-15-13-19(14-16-34)18-5-9-22(10-6-18)33-27(37)23-3-1-2-4-24(23)38-28(30)31/h1-12,19,28H,13-17H2,(H,32,35)(H,33,37) |
| InChIKey | DKSPWTYPTVBMEF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|