C18H25N3O5S — CID 171711614
(3R,4S)-4-(dimethylamino)-4-phenyl-1-(1,3-thiazol-2-yl)piperidin-3-ol;formic acid (PubChem CID 171711614) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is (3R,4S)-4-(dimethylamino)-4-phenyl-1-(1,3-thiazol-2-yl)piperidin-3-ol;formic acid.
| Compound Name | (3R,4S)-4-(dimethylamino)-4-phenyl-1-(1,3-thiazol-2-yl)piperidin-3-ol;formic acid |
|---|---|
| PubChem CID | 171711614 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3R,4S)-4-(dimethylamino)-4-phenyl-1-(1,3-thiazol-2-yl)piperidin-3-ol;formic acid |
| SMILES | CN(C)[C@]1(c2ccccc2)CCN(c2nccs2)C[C@H]1O.O=CO.O=CO |
| InChI | InChI=1S/C16H21N3OS.2CH2O2/c1-18(2)16(13-6-4-3-5-7-13)8-10-19(12-14(16)20)15-17-9-11-21-15;2*2-1-3/h3-7,9,11,14,20H,8,10,12H2,1-2H3;2*1H,(H,2,3)/t14-,16+;;/m1../s1 |
| InChIKey | QDDMOLBKSCJODH-WUTOMRCLSA-N |
| XLogP | 1.57 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|