C27H21F6O4S+ — CID 171721702
[4-[2-oxo-2-[1,1,1-trifluoro-2-(trifluoromethyl)pent-4-en-2-yl]oxyethoxy]carbonylphenyl]-diphenylsulfanium (PubChem CID 171721702) has the molecular formula C27H21F6O4S+ and a molecular weight of 555.52 g/mol. Its IUPAC name is [4-[2-oxo-2-[1,1,1-trifluoro-2-(trifluoromethyl)pent-4-en-2-yl]oxyethoxy]carbonylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-oxo-2-[1,1,1-trifluoro-2-(trifluoromethyl)pent-4-en-2-yl]oxyethoxy]carbonylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 171721702 |
| Molecular Formula | C27H21F6O4S+ |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | [4-[2-oxo-2-[1,1,1-trifluoro-2-(trifluoromethyl)pent-4-en-2-yl]oxyethoxy]carbonylphenyl]-diphenylsulfanium |
| SMILES | C=CCC(OC(=O)COC(=O)c1ccc([S+](c2ccccc2)c2ccccc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H21F6O4S/c1-2-17-25(26(28,29)30,27(31,32)33)37-23(34)18-36-24(35)19-13-15-22(16-14-19)38(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h2-16H,1,17-18H2/q+1 |
| InChIKey | XWZSLJIJJYJJIS-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|