C25H16F9O4S+ — CID 171721725
[4-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-oxoethoxy]carbonylphenyl]-diphenylsulfanium (PubChem CID 171721725) has the molecular formula C25H16F9O4S+ and a molecular weight of 583.45 g/mol. Its IUPAC name is [4-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-oxoethoxy]carbonylphenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-oxoethoxy]carbonylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 171721725 |
| Molecular Formula | C25H16F9O4S+ |
| Molecular Weight | 583.45 g/mol |
| Exact Mass | 583.06 |
| IUPAC Name | [4-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-oxoethoxy]carbonylphenyl]-diphenylsulfanium |
| SMILES | O=C(COC(=O)c1ccc([S+](c2ccccc2)c2ccccc2)cc1)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H16F9O4S/c26-23(27,28)22(24(29,30)31,25(32,33)34)38-20(35)15-37-21(36)16-11-13-19(14-12-16)39(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14H,15H2/q+1 |
| InChIKey | CHCXDPFMSYXYSZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.45 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|