C12H13NO3 — CID 171725879
7-amino-4-methoxy-3,6,7,8-tetrahydrocyclopenta[g][1]benzofuran-2-one (PubChem CID 171725879) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 7-amino-4-methoxy-3,6,7,8-tetrahydrocyclopenta[g][1]benzofuran-2-one.
| Compound Name | 7-amino-4-methoxy-3,6,7,8-tetrahydrocyclopenta[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 171725879 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 7-amino-4-methoxy-3,6,7,8-tetrahydrocyclopenta[g][1]benzofuran-2-one |
| SMILES | COc1cc2c(c3c1CC(=O)O3)CC(N)C2 |
| InChI | InChI=1S/C12H13NO3/c1-15-10-3-6-2-7(13)4-8(6)12-9(10)5-11(14)16-12/h3,7H,2,4-5,13H2,1H3 |
| InChIKey | GDAZHKNIHDEXGE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|