C12H13NO2 — CID 171725940
8-amino-4,7,8,9-tetrahydro-3H-cyclopenta[h]chromen-2-one (PubChem CID 171725940) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 8-amino-4,7,8,9-tetrahydro-3H-cyclopenta[h]chromen-2-one.
| Compound Name | 8-amino-4,7,8,9-tetrahydro-3H-cyclopenta[h]chromen-2-one |
|---|---|
| PubChem CID | 171725940 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 8-amino-4,7,8,9-tetrahydro-3H-cyclopenta[h]chromen-2-one |
| SMILES | NC1Cc2ccc3c(c2C1)OC(=O)CC3 |
| InChI | InChI=1S/C12H13NO2/c13-9-5-8-2-1-7-3-4-11(14)15-12(7)10(8)6-9/h1-2,9H,3-6,13H2 |
| InChIKey | DCVVYTMYMAUTEJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|