C10H11Cl2N2O+ — CID 171731847
(5,7-dichloro-6-methoxy-1H-indol-2-yl)methylazanium (PubChem CID 171731847) has the molecular formula C10H11Cl2N2O+ and a molecular weight of 246.12 g/mol. Its IUPAC name is (5,7-dichloro-6-methoxy-1H-indol-2-yl)methylazanium.
| Compound Name | (5,7-dichloro-6-methoxy-1H-indol-2-yl)methylazanium |
|---|---|
| PubChem CID | 171731847 |
| Molecular Formula | C10H11Cl2N2O+ |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | (5,7-dichloro-6-methoxy-1H-indol-2-yl)methylazanium |
| SMILES | COc1c(Cl)cc2cc(C[NH3+])[nH]c2c1Cl |
| InChI | InChI=1S/C10H10Cl2N2O/c1-15-10-7(11)3-5-2-6(4-13)14-9(5)8(10)12/h2-3,14H,4,13H2,1H3/p+1 |
| InChIKey | VBGSVEWOMGKUBV-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 52.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |