C26H10Cl2N4Se2 — CID 171734462
2-[(5E)-4-(4-chlorophenyl)-5-[3-(4-chlorophenyl)-5-(diisocyanomethylidene)selenophen-2-ylidene]selenophen-2-ylidene]propanedinitrile (PubChem CID 171734462) has the molecular formula C26H10Cl2N4Se2 and a molecular weight of 607.22 g/mol. Its IUPAC name is 2-[(5E)-4-(4-chlorophenyl)-5-[3-(4-chlorophenyl)-5-(diisocyanomethylidene)selenophen-2-ylidene]selenophen-2-ylidene]propanedinitrile.
| Compound Name | 2-[(5E)-4-(4-chlorophenyl)-5-[3-(4-chlorophenyl)-5-(diisocyanomethylidene)selenophen-2-ylidene]selenophen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 171734462 |
| Molecular Formula | C26H10Cl2N4Se2 |
| Molecular Weight | 607.22 g/mol |
| Exact Mass | 607.86 |
| IUPAC Name | 2-[(5E)-4-(4-chlorophenyl)-5-[3-(4-chlorophenyl)-5-(diisocyanomethylidene)selenophen-2-ylidene]selenophen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=c1cc(-c2ccc(Cl)cc2)/c(=c2\[se]c(=C(C#N)C#N)cc2-c2ccc(Cl)cc2)[se]1 |
| InChI | InChI=1S/C26H10Cl2N4Se2/c1-31-26(32-2)23-12-21(16-5-9-19(28)10-6-16)25(34-23)24-20(15-3-7-18(27)8-4-15)11-22(33-24)17(13-29)14-30/h3-12H/b25-24+ |
| InChIKey | HZJDENVPGJMBAD-OCOZRVBESA-N |
| XLogP | 4.83 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|